EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H17NO7 |
| Net Charge | 0 |
| Average Mass | 395.367 |
| Monoisotopic Mass | 395.10050 |
| SMILES | O=C(O)CNC(=O)/C(=C1/OCO/C1=C(/C(=O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17NO7/c23-15(24)11-22-20(25)16(13-7-3-1-4-8-13)18-19(29-12-28-18)17(21(26)27)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,22,25)(H,23,24)(H,26,27)/b18-16+,19-17+ |
| InChIKey | QUIONHAMCPPZRR-YWNVXTCZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tricholoma ustale (ncbitaxon:113601) | - | PubMed (12125567) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-2-[(5E)-5-[2-(carboxymethylamino)-2-oxo-1-phenylethylidene]-1,3-dioxolan-4-ylidene]-2-phenylacetic acid (CHEBI:222491) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2E)-2-[(5E)-5-[2-(carboxymethylamino)-2-oxo-1-phenylethylidene]-1,3-dioxolan-4-ylidene]-2-phenylacetic acid |
| Manual Xrefs | Databases |
|---|---|
| 10298262 | ChemSpider |