EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H20O9 |
| Net Charge | 0 |
| Average Mass | 452.415 |
| Monoisotopic Mass | 452.11073 |
| SMILES | CCOC(=O)/C(=C\c1ccc(O)c(O)c1)c1c(O)cc(/C=C/c2ccc(O)c(O)c2)oc1=O |
| InChI | InChI=1S/C24H20O9/c1-2-32-23(30)16(9-14-5-8-18(26)20(28)11-14)22-21(29)12-15(33-24(22)31)6-3-13-4-7-17(25)19(27)10-13/h3-12,25-29H,2H2,1H3/b6-3+,16-9- |
| InChIKey | ILJIUGHJNCYQIT-PGODXZJGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sanghuangporus baumii (ncbitaxon:108892) | - | PubMed (21531558) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phellibaumin E (CHEBI:222480) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| ethyl (Z)-3-(3,4-dihydroxyphenyl)-2-[6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-2-oxopyran-3-yl]prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 26336888 | ChemSpider |