EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O7 |
| Net Charge | 0 |
| Average Mass | 460.567 |
| Monoisotopic Mass | 460.24610 |
| SMILES | C=C(C)[C@H]1CC[C@@]2(C)[C@@H](C[C@]3(C)C(=C)[C@@]2(C(=O)OC)C(=O)[C@@](C)(O)C3=O)[C@]1(C)CCC(=O)O |
| InChI | InChI=1S/C26H36O7/c1-14(2)16-9-12-24(6)17(22(16,4)11-10-18(27)28)13-23(5)15(3)26(24,21(31)33-8)20(30)25(7,32)19(23)29/h16-17,32H,1,3,9-13H2,2,4-8H3,(H,27,28)/t16-,17+,22-,23-,24+,25+,26+/m1/s1 |
| InChIKey | UBSPPCVCFCCMKE-YUSCWSESSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies SF-5497 (ncbitaxon:1855734) | - | PubMed (31019257) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Preaustinoid A7 (CHEBI:222447) is a carbocyclic fatty acid (CHEBI:35744) |
| IUPAC Name |
|---|
| 3-[(1R,2S,5R,6R,7S,9R,11S)-11-hydroxy-1-methoxycarbonyl-2,6,9,11-tetramethyl-13-methylidene-10,12-dioxo-5-prop-1-en-2-yl-6-tricyclo[7.3.1.02,7]tridecanyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 76827110 | ChemSpider |