EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22Cl2O6 |
| Net Charge | 0 |
| Average Mass | 417.285 |
| Monoisotopic Mass | 416.07934 |
| SMILES | C/C=C/[C@@H]1C(C(=O)O)=C[C@H](C)[C@H](C)[C@H]1C1=C(Cl)C(=O)[C@@H](Cl)[C@@]1(O)C(=O)OC |
| InChI | InChI=1S/C19H22Cl2O6/c1-5-6-10-11(17(23)24)7-8(2)9(3)12(10)13-14(20)15(22)16(21)19(13,26)18(25)27-4/h5-10,12,16,26H,1-4H3,(H,23,24)/b6-5+/t8-,9-,10+,12+,16+,19+/m0/s1 |
| InChIKey | FIIGEIPJQPSSEU-SWEVXGTLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Roussoella (ncbitaxon:63193) | - | PubMed (26444492) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Roubetaoellatide (CHEBI:222446) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (3R,4S,5R,6S)-5-[(4S,5S)-2,4-dichloro-5-hydroxy-5-methoxycarbonyl-3-oxocyclopenten-1-yl]-3,4-dimethyl-6-[(E)-prop-1-enyl]cyclohexene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 40256693 | ChemSpider |