EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H57N5O10 |
| Net Charge | 0 |
| Average Mass | 719.877 |
| Monoisotopic Mass | 719.41054 |
| SMILES | CCCCCC1CC(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(C(C)O)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(C(C)CC)C(=O)O1 |
| InChI | InChI=1S/C36H57N5O10/c1-7-9-10-11-25-18-29(45)37-26(16-20(3)4)32(46)39-28(19-42)34(48)41-31(22(6)43)35(49)38-27(17-23-12-14-24(44)15-13-23)33(47)40-30(21(5)8-2)36(50)51-25/h12-15,20-22,25-28,30-31,42-44H,7-11,16-19H2,1-6H3,(H,37,45)(H,38,49)(H,39,46)(H,40,47)(H,41,48) |
| InChIKey | UBRJKOFIBHGLGB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Serratia (ncbitaxon:613) | - | PubMed (35438991) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Serrawettin W2-YI8 (CHEBI:222444) is a cyclodepsipeptide (CHEBI:35213) |