EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H59N5O10 |
| Net Charge | 0 |
| Average Mass | 733.904 |
| Monoisotopic Mass | 733.42619 |
| SMILES | CCCCCCCC1CC(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(C(C)O)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(C(C)C)C(=O)O1 |
| InChI | InChI=1S/C37H59N5O10/c1-7-8-9-10-11-12-26-19-30(46)38-27(17-21(2)3)33(47)40-29(20-43)35(49)42-32(23(6)44)36(50)39-28(18-24-13-15-25(45)16-14-24)34(48)41-31(22(4)5)37(51)52-26/h13-16,21-23,26-29,31-32,43-45H,7-12,17-20H2,1-6H3,(H,38,46)(H,39,50)(H,40,47)(H,41,48)(H,42,49) |
| InChIKey | ZARKPRBMUMRXKQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Serratia (ncbitaxon:613) | - | PubMed (35438991) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Serrawettin W2-YV10 (CHEBI:222438) is a cyclodepsipeptide (CHEBI:35213) |