EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H55N5O9 |
| Net Charge | 0 |
| Average Mass | 689.851 |
| Monoisotopic Mass | 689.39998 |
| SMILES | CCCCCC1CC(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(C(C)O)C(=O)NC(Cc2ccccc2)C(=O)NC(C(C)C)C(=O)O1 |
| InChI | InChI=1S/C35H55N5O9/c1-7-8-10-15-24-18-28(43)36-25(16-20(2)3)31(44)38-27(19-41)33(46)40-30(22(6)42)34(47)37-26(17-23-13-11-9-12-14-23)32(45)39-29(21(4)5)35(48)49-24/h9,11-14,20-22,24-27,29-30,41-42H,7-8,10,15-19H2,1-6H3,(H,36,43)(H,37,47)(H,38,44)(H,39,45)(H,40,46) |
| InChIKey | BPOMHWQTODEGPS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Serratia (ncbitaxon:613) | - | PubMed (35438991) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Serrawettin W2-FV8 (CHEBI:222434) is a cyclodepsipeptide (CHEBI:35213) |