EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H37N7O11 |
| Net Charge | 0 |
| Average Mass | 635.631 |
| Monoisotopic Mass | 635.25511 |
| SMILES | O=CN(O)CCC[C@H](NC(=O)[C@@H](CO)NC(=O)CCNC(=O)[C@@H]1COC(c2ccccc2O)=N1)C(=O)N[C@H]1CCCN(O)C1=O |
| InChI | InChI=1S/C27H37N7O11/c35-13-19(29-22(38)9-10-28-23(39)20-14-45-26(32-20)16-5-1-2-8-21(16)37)25(41)30-17(6-3-11-33(43)15-36)24(40)31-18-7-4-12-34(44)27(18)42/h1-2,5,8,15,17-20,35,37,43-44H,3-4,6-7,9-14H2,(H,28,39)(H,29,38)(H,30,41)(H,31,40)/t17-,18-,19+,20-/m0/s1 |
| InChIKey | DACSYISDDNBIGD-HAGHYFMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudonocardiaspecies (ncbitaxon:60912) | - | PubMed (33655067) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Attinimicin (CHEBI:222421) is a peptide (CHEBI:16670) |