EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:222417 - fluopsin C
| Formula | C4H8CuN2O2S2 |
| Net Charge | 0 |
| Average Mass | 243.800 |
| Monoisotopic Mass | 242.93232 |
| SMILES | CN1C=[S][Cu]2([O]1)[O]N(C)C=[S]2 |
| InChI | InChI=1S/2C2H4NOS.Cu/c2*1-3(4)2-5;/h2*2H,1H3;/q2*-1;+2 |
| InChIKey | PGYZQLIUYISMJD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas aeruginosa (ncbitaxon:287) | - | PubMed (34793213) | |
| Pseudomonas fluorescens (ncbitaxon:294) | cell culture (BTO:0000214) | PubMed (4468081) | Strain: MCRL-10107 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluopsin C (CHEBI:222417) has role antibacterial agent (CHEBI:33282) |
| fluopsin C (CHEBI:222417) has role antineoplastic agent (CHEBI:35610) |
| fluopsin C (CHEBI:222417) has role bacterial metabolite (CHEBI:76969) |
| fluopsin C (CHEBI:222417) has role hepatotoxic agent (CHEBI:50908) |
| fluopsin C (CHEBI:222417) is a copper coordination entity (CHEBI:37403) |
| IUPAC Name |
|---|
| bis(N-hydroxy-κO-N-methylthioformamidato-κS)copper |
| Synonyms | Source |
|---|---|
| bis(N-methylthioformohydroxamato)copper | ChEBI |
| copper(2+) bis{[methanethioyl(methyl)amino]oxidanide} | ChEBI |
| antibiotic YC-73 | ChEBI |
| YC-73 | ChEBI |
| YC 73 | ChEBI |
| bis(N-methylthioformohydroxamato)copper(II) | ChEBI |
| UniProt Name | Source |
|---|---|
| fluopsin C | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 148058 | ChemSpider |
| WO2004050095 | Patent |
| WO2004078179 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:31323-25-8 | ChEBI |
| Citations |
|---|