EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N5O5 |
| Net Charge | 0 |
| Average Mass | 443.504 |
| Monoisotopic Mass | 443.21687 |
| SMILES | CN[C@H]1Cc2ccc(O)c(c2)-n2cncc2C[C@@H](C(=O)O)NC(=O)[C@H](CC(C)C)NC1=O |
| InChI | InChI=1S/C22H29N5O5/c1-12(2)6-16-21(30)26-17(22(31)32)9-14-10-24-11-27(14)18-8-13(4-5-19(18)28)7-15(23-3)20(29)25-16/h4-5,8,10-12,15-17,23,28H,6-7,9H2,1-3H3,(H,25,29)(H,26,30)(H,31,32)/t15-,16-,17-/m0/s1 |
| InChIKey | YNCKCZXUTZJZTQ-ULQDDVLXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pyxidicoccus (ncbitaxon:224458) | - | PubMed (34946566) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Myxarylin (CHEBI:222409) is a polypeptide (CHEBI:15841) |