EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N4O7 |
| Net Charge | 0 |
| Average Mass | 370.362 |
| Monoisotopic Mass | 370.14885 |
| SMILES | O=C(O)CC[C@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@H](CO)NC(=O)CNC1=O |
| InChI | InChI=1S/C15H22N4O7/c20-7-9-15(26)19-5-1-2-10(19)14(25)18-8(3-4-12(22)23)13(24)16-6-11(21)17-9/h8-10,20H,1-7H2,(H,16,24)(H,17,21)(H,18,25)(H,22,23)/t8-,9+,10+/m1/s1 |
| InChIKey | HCPCZMCZJYSIAJ-UTLUCORTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ruegeriaspecies (ncbitaxon:1879320) | - | PubMed (15270577) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclo-(glycyl-L-seryl-L-prolyl-L-glutamyl) (CHEBI:222386) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| 3-[(3S,9R,12S)-3-(hydroxymethyl)-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442730 | ChemSpider |