EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27N3O7 |
| Net Charge | 0 |
| Average Mass | 481.505 |
| Monoisotopic Mass | 481.18490 |
| SMILES | CCCCC[C@@H](C(=O)O)[C@H](OC(=O)CNC=O)c1cccc2nc3c(C(=O)OC)cccc3nc12 |
| InChI | InChI=1S/C25H27N3O7/c1-3-4-5-8-17(24(31)32)23(35-20(30)13-26-14-29)15-9-6-11-18-21(15)27-19-12-7-10-16(22(19)28-18)25(33)34-2/h6-7,9-12,14,17,23H,3-5,8,13H2,1-2H3,(H,26,29)(H,31,32)/t17-,23-/m1/s1 |
| InChIKey | OTCCUSGSKVTNEX-UZUQRXQVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (30853419) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Streptophenazine R (CHEBI:222354) is a depsipeptide (CHEBI:23643) |