EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H63N7O5 |
| Net Charge | 0 |
| Average Mass | 625.900 |
| Monoisotopic Mass | 625.48907 |
| SMILES | CN[C@H](C(=O)N[C@H](C(=O)N(C)[C@H](C(=O)N(C)[C@H](C(=O)N[C@H](C(=O)NCCCCN)C(C)C)C(C)C)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C32H63N7O5/c1-18(2)23(34-11)29(41)37-25(20(5)6)31(43)39(13)27(22(9)10)32(44)38(12)26(21(7)8)30(42)36-24(19(3)4)28(40)35-17-15-14-16-33/h18-27,34H,14-17,33H2,1-13H3,(H,35,40)(H,36,42)(H,37,41)/t23-,24-,25-,26-,27-/m0/s1 |
| InChIKey | AZYAXSZUCISPAC-IRGGMKSGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Photorhabdus luminescens (ncbitaxon:29488) | - | PubMed (25826784) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mevalagmapeptide B (CHEBI:222339) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-(4-aminobutylamino)-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide |