EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H53N5O5 |
| Net Charge | 0 |
| Average Mass | 599.817 |
| Monoisotopic Mass | 599.40467 |
| SMILES | CCC(C)C1NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(Cc2ccccc2)NC(=O)C(CC(C)C)NC1=O |
| InChI | InChI=1S/C33H53N5O5/c1-9-22(8)28-33(43)37-25(16-20(4)5)30(40)36-27(18-23-13-11-10-12-14-23)31(41)34-24(15-19(2)3)29(39)35-26(17-21(6)7)32(42)38-28/h10-14,19-22,24-28H,9,15-18H2,1-8H3,(H,34,41)(H,35,39)(H,36,40)(H,37,43)(H,38,42) |
| InChIKey | KODHWKVDRQFNRE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Photorhabdus (ncbitaxon:29487) | - | PubMed (25683597) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Luminmide C (CHEBI:222333) is a oligopeptide (CHEBI:25676) |