EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27N5O7 |
| Net Charge | 0 |
| Average Mass | 437.453 |
| Monoisotopic Mass | 437.19105 |
| SMILES | N[C@H](CCCNC(=O)c1cccc(O)c1O)C(=O)NCC(=O)N[C@H]1CCCN(O)C1=O |
| InChI | InChI=1S/C19H27N5O7/c20-12(5-2-8-21-17(28)11-4-1-7-14(25)16(11)27)18(29)22-10-15(26)23-13-6-3-9-24(31)19(13)30/h1,4,7,12-13,25,27,31H,2-3,5-6,8-10,20H2,(H,21,28)(H,22,29)(H,23,26)/t12-,13+/m1/s1 |
| InChIKey | KZSYVXPBQDRSRR-OLZOCXBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhodococcus (ncbitaxon:1827) | - | PubMed (11508844) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Heterobactin B (CHEBI:222330) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| N-[(4R)-4-amino-5-[[2-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-2-oxoethyl]amino]-5-oxopentyl]-2,3-dihydroxybenzamide |