EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N2O8 |
| Net Charge | 0 |
| Average Mass | 424.450 |
| Monoisotopic Mass | 424.18457 |
| SMILES | C[C@H](O)CCC(=O)C[C@H](N[C@@H](C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H28N2O8/c1-11(23)3-6-15(25)10-17(20(29)30)21-12(2)18(26)22-16(19(27)28)9-13-4-7-14(24)8-5-13/h4-5,7-8,11-12,16-17,21,23-24H,3,6,9-10H2,1-2H3,(H,22,26)(H,27,28)(H,29,30)/t11-,12-,16-,17-/m0/s1 |
| InChIKey | VOFCPUVKMIAYMR-SYWGBEHUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Doratomyces (ncbitaxon:186351) | - | PubMed (3034846) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| WF-10129 (CHEBI:222306) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,7S)-2-[[(2S)-1-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-1-oxopropan-2-yl]amino]-7-hydroxy-4-oxooctanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 2338684 | ChemSpider |