EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O6 |
| Net Charge | 0 |
| Average Mass | 278.260 |
| Monoisotopic Mass | 278.07904 |
| SMILES | Cc1cc(O)cc(O)c1C(=O)OC1=CO[C@@H](C)CC1=O |
| InChI | InChI=1S/C14H14O6/c1-7-3-9(15)5-11(17)13(7)14(18)20-12-6-19-8(2)4-10(12)16/h3,5-6,8,15,17H,4H2,1-2H3/t8-/m0/s1 |
| InChIKey | DWLLTZQBTFJUAM-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium (ncbitaxon:5149) | - | PubMed (25855820) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Orsellide E (CHEBI:222300) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (2-methyl-4-oxo-2,3-dihydropyran-5-yl) 2,4-dihydroxy-6-methylbenzoate |
| Manual Xrefs | Databases |
|---|---|
| 78435039 | ChemSpider |