EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31N5O7 |
| Net Charge | 0 |
| Average Mass | 429.474 |
| Monoisotopic Mass | 429.22235 |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)C(CO)NC(C)[C@H](C(=O)O)NC1=O |
| InChI | InChI=1S/C18H31N5O7/c1-7(2)12-17(28)23-13(18(29)30)8(3)19-11(6-24)16(27)21-9(4)14(25)20-10(5)15(26)22-12/h7-13,19,24H,6H2,1-5H3,(H,20,25)(H,21,27)(H,22,26)(H,23,28)(H,29,30)/t8?,9-,10-,11?,12-,13+/m0/s1 |
| InChIKey | BSUMIOWTSZNJFO-ALRRKWCXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (34442719) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bonsecamin (CHEBI:222280) is a polypeptide (CHEBI:15841) |