EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H55N9O10 |
| Net Charge | 0 |
| Average Mass | 749.867 |
| Monoisotopic Mass | 749.40719 |
| SMILES | CC(C)C[C@@H](NC(=O)[C@@H](NC(=O)[C@H](N)[C@@H](C)O)[C@H](O)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)O)[C@@H](C)O)[C@@H]1CCN=C(N)N1)C(C)C |
| InChI | InChI=1S/C34H55N9O10/c1-15(2)14-21(38-32(51)26(43-29(48)22(35)17(5)44)27(46)19-10-8-7-9-11-19)28(47)40-23(16(3)4)30(49)42-25(20-12-13-37-34(36)39-20)31(50)41-24(18(6)45)33(52)53/h7-11,15-18,20-27,44-46H,12-14,35H2,1-6H3,(H,38,51)(H,40,47)(H,41,50)(H,42,49)(H,43,48)(H,52,53)(H3,36,37,39)/t17-,18-,20+,21-,22-,23+,24+,25-,26+,27-/m1/s1 |
| InChIKey | LKCJCCHYLKXZBH-NBTIRUIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces albus (ncbitaxon:1888) | - | PubMed (34442689) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Iso-faulknamycin (CHEBI:222277) is a polypeptide (CHEBI:15841) |