EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H53N9O9 |
| Net Charge | 0 |
| Average Mass | 731.852 |
| Monoisotopic Mass | 731.39662 |
| SMILES | CC(C)C[C@H]1NC(=O)[C@H]([C@H](O)c2ccccc2)NC(=O)[C@@H]([C@@H](C)O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H]([C@@H]2CCN=C(N)N2)NC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C34H53N9O9/c1-15(2)14-21-28(47)39-22(16(3)4)29(48)42-25(20-12-13-36-34(35)38-20)32(51)41-23(17(5)44)30(49)40-24(18(6)45)31(50)43-26(33(52)37-21)27(46)19-10-8-7-9-11-19/h7-11,15-18,20-27,44-46H,12-14H2,1-6H3,(H,37,52)(H,39,47)(H,40,49)(H,41,51)(H,42,48)(H,43,50)(H3,35,36,38)/t17-,18-,20+,21-,22+,23+,24-,25-,26+,27-/m1/s1 |
| InChIKey | NOYQINGQXLDCJC-GIWLXFSNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces albus (ncbitaxon:1888) | - | PubMed (34442689) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclofaulknamycin (CHEBI:222271) is a oligopeptide (CHEBI:25676) |