EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28N8O5 |
| Net Charge | 0 |
| Average Mass | 436.473 |
| Monoisotopic Mass | 436.21827 |
| SMILES | CC(CCN(C)C(=N)N)C(N)C(=O)NC1C=CC(n2ccc(N)nc2=O)OC1C(=O)O |
| InChI | InChI=1S/C18H28N8O5/c1-9(5-7-25(2)17(21)22)13(20)15(27)23-10-3-4-12(31-14(10)16(28)29)26-8-6-11(19)24-18(26)30/h3-4,6,8-10,12-14H,5,7,20H2,1-2H3,(H3,21,22)(H,23,27)(H,28,29)(H2,19,24,30) |
| InChIKey | QHXNKYPHTJBRJV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (3610832) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arginomycin (CHEBI:222256) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 3-[[2-amino-5-[carbamimidoyl(methyl)amino]-3-methylpentanoyl]amino]-6-(4-amino-2-oxopyrimidin-1-yl)-3,6-dihydro-2H-pyran-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 114715 | ChemSpider |