EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O7 |
| Net Charge | 0 |
| Average Mass | 396.395 |
| Monoisotopic Mass | 396.12090 |
| SMILES | CC(C)C(=O)O[C@@H]1c2c(cc(O)c3c2C(=O)c2cccc(O)c2-3)C(=O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C22H20O7/c1-8(2)22(28)29-21-15-11(18(25)9(3)19(21)26)7-13(24)16-14-10(20(27)17(15)16)5-4-6-12(14)23/h4-9,19,21,23-24,26H,1-3H3/t9-,19+,21+/m0/s1 |
| InChIKey | ZWZDPCODGBCKJZ-VRPSQQPASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Micromonospora (ncbitaxon:1873) | - | PubMed (23136829) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fluostatin I (CHEBI:222253) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| [(1R,2R,3R)-2,6,7-trihydroxy-3-methyl-4,11-dioxo-2,3-dihydro-1H-benzo[a]luoren-1-yl] 2-methylpropanoate |
| Manual Xrefs | Databases |
|---|---|
| 28644194 | ChemSpider |