EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H41NO7 |
| Net Charge | 0 |
| Average Mass | 431.570 |
| Monoisotopic Mass | 431.28830 |
| SMILES | CCCCCC[C@@H](O)CCCCCC/C=C/[C@@H](O)[C@@H](OC(C)=O)[C@@H](O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C22H41NO7/c1-3-4-5-10-13-17(25)14-11-8-6-7-9-12-15-18(26)21(30-16(2)24)20(27)19(23)22(28)29/h12,15,17-21,25-27H,3-11,13-14,23H2,1-2H3,(H,28,29)/b15-12+/t17-,18-,19+,20+,21-/m1/s1 |
| InChIKey | OOEOVXMORBPOKC-HQBCPPEBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (3305454) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fumifungin (CHEBI:222250) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E,2S,3S,4R,5R,14R)-4-acetyloxy-2-amino-3,5,14-trihydroxyicos-6-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442994 | ChemSpider |