EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H52N4O7 |
| Net Charge | 0 |
| Average Mass | 640.822 |
| Monoisotopic Mass | 640.38360 |
| SMILES | C#CCCCC1NC(=O)[C@H](C)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](Cc2ccc(OC)cc2)N(C)C(=O)C(C(C)CC)OC(=O)C1C |
| InChI | InChI=1S/C35H52N4O7/c1-11-13-14-15-27-23(6)35(44)46-30(22(5)12-2)34(43)39(9)28(20-25-16-18-26(45-10)19-17-25)32(41)37-29(21(3)4)33(42)38(8)24(7)31(40)36-27/h1,16-19,21-24,27-30H,12-15,20H2,2-10H3,(H,36,40)(H,37,41)/t22?,23?,24-,27?,28-,29-,30?/m0/s1 |
| InChIKey | LTQSSFDXKQDYDB-RGHLRUQMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | PubMed (12828459) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guineamide C (CHEBI:222245) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (5S,8S,11S)-2-butan-2-yl-5-[(4-methoxyphenyl)methyl]-4,10,11,15-tetramethyl-14-pent-4-ynyl-8-propan-2-yl-1-oxa-4,7,10,13-tetrazacyclohexadecane-3,6,9,12,16-pentone |
| Manual Xrefs | Databases |
|---|---|
| 8230475 | ChemSpider |