EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H62Cl2N6O13 |
| Net Charge | 0 |
| Average Mass | 953.915 |
| Monoisotopic Mass | 952.37519 |
| SMILES | C/C=C(\NC(=O)/C(=C/c1cc(Cl)c(O)c(Cl)c1)OC)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@H](C)[C@@H](OC(C)=O)C[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N(O)[C@H](C(=O)N1[C@@H](C)C[C@H]1C(=O)O)C(C)C |
| InChI | InChI=1S/C44H62Cl2N6O13/c1-12-29(47-40(57)35(64-11)18-26-16-27(45)37(54)28(46)17-26)38(55)48-30(13-20(2)3)41(58)51-24(9)34(65-25(10)53)19-32(51)39(56)49-31(14-21(4)5)42(59)52(63)36(22(6)7)43(60)50-23(8)15-33(50)44(61)62/h12,16-18,20-24,30-34,36,54,63H,13-15,19H2,1-11H3,(H,47,57)(H,48,55)(H,49,56)(H,61,62)/b29-12-,35-18-/t23-,24+,30-,31-,32-,33-,34-,36-/m0/s1 |
| InChIKey | KNXJPIWWQWMTSD-IUATYZGISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (33979513) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bonnevillamide E (CHEBI:222236) is a oligopeptide (CHEBI:25676) |