EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N4O6 |
| Net Charge | 0 |
| Average Mass | 288.260 |
| Monoisotopic Mass | 288.10698 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CNC(=O)[C@@H]1O[C@H]1C(N)=O)C(=O)O |
| InChI | InChI=1S/C10H16N4O6/c1-3(11)8(16)14-4(10(18)19)2-13-9(17)6-5(20-6)7(12)15/h3-6H,2,11H2,1H3,(H2,12,15)(H,13,17)(H,14,16)(H,18,19)/t3-,4-,5+,6+/m0/s1 |
| InChIKey | QZCAFCAHKABCMV-UNTFVMJOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Micromonospora (ncbitaxon:1873) | - | PubMed (3346184) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sch 37137 (CHEBI:222232) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-[[(2R,3R)-3-carbamoyloxirane-2-carbonyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9315861 | ChemSpider |