EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H64Cl2N6O14 |
| Net Charge | 0 |
| Average Mass | 971.930 |
| Monoisotopic Mass | 970.38576 |
| SMILES | CO/C(=C\c1cc(Cl)c(O)c(Cl)c1)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N1[C@H](C)[C@@H](OC(C)=O)C[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N(O)[C@H](C(=O)N1[C@@H](C)C[C@H]1C(=O)O)C(C)C)[C@@H](C)O |
| InChI | InChI=1S/C44H64Cl2N6O14/c1-19(2)12-29(48-40(58)35(24(9)53)49-39(57)34(65-11)17-26-15-27(45)37(55)28(46)16-26)41(59)51-23(8)33(66-25(10)54)18-31(51)38(56)47-30(13-20(3)4)42(60)52(64)36(21(5)6)43(61)50-22(7)14-32(50)44(62)63/h15-17,19-24,29-33,35-36,53,55,64H,12-14,18H2,1-11H3,(H,47,56)(H,48,58)(H,49,57)(H,62,63)/b34-17-/t22-,23+,24+,29-,30-,31-,32-,33-,35-,36-/m0/s1 |
| InChIKey | LMBVXCIECVQZON-HYJPTLHKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (33979513) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bonnevillamide D (CHEBI:222231) is a oligopeptide (CHEBI:25676) |