EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O8 |
| Net Charge | 0 |
| Average Mass | 320.253 |
| Monoisotopic Mass | 320.05322 |
| SMILES | COC1=CC(=O)c2c(O)c(C(=O)O)c(CC(C)=O)c(O)c2C1=O |
| InChI | InChI=1S/C15H12O8/c1-5(16)3-6-9(15(21)22)14(20)10-7(17)4-8(23-2)13(19)11(10)12(6)18/h4,18,20H,3H2,1-2H3,(H,21,22) |
| InChIKey | JCQVSLPRIQVCHH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusarubinoic acid (CHEBI:222226) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| 1,4-dihydroxy-6-methoxy-5,8-dioxo-3-(2-oxopropyl)naphthalene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 35763943 | ChemSpider |