EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O3 |
| Net Charge | 0 |
| Average Mass | 322.489 |
| Monoisotopic Mass | 322.25079 |
| SMILES | [H][C@@]12[C@H](O)C(CO)=C[C@@]3([H])[C@@H](C(C)C)CC[C@@H](C)[C@]1([H])CC[C@@H](C)[C@@]23O |
| InChI | InChI=1S/C20H34O3/c1-11(2)15-7-5-12(3)16-8-6-13(4)20(23)17(15)9-14(10-21)19(22)18(16)20/h9,11-13,15-19,21-23H,5-8,10H2,1-4H3/t12-,13-,15-,16+,17+,18+,19-,20+/m1/s1 |
| InChIKey | WVVCBUGDSFLEHX-SBNBNJMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Virgaria nigra (ncbitaxon:1085564) | mycelium (BTO:0001436) | PubMed (3346190) | Strain: F-5408 |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vinigrol (CHEBI:222218) has role antihypertensive agent (CHEBI:35674) |
| vinigrol (CHEBI:222218) has role fungal metabolite (CHEBI:76946) |
| vinigrol (CHEBI:222218) has role platelet aggregation inhibitor (CHEBI:50427) |
| vinigrol (CHEBI:222218) is a carbotricyclic compound (CHEBI:38032) |
| vinigrol (CHEBI:222218) is a diterpenoid (CHEBI:23849) |
| vinigrol (CHEBI:222218) is a primary alcohol (CHEBI:15734) |
| vinigrol (CHEBI:222218) is a secondary alcohol (CHEBI:35681) |
| vinigrol (CHEBI:222218) is a tertiary alcohol (CHEBI:26878) |
| vinigrol (CHEBI:222218) is a triol (CHEBI:27136) |
| Incoming Relation(s) |
| 16-dehydroxyvinigrol (CHEBI:234555) has functional parent vinigrol (CHEBI:222218) |
| 4,16-didehydroxyvinigrol (CHEBI:234556) has functional parent vinigrol (CHEBI:222218) |
| IUPAC Name |
|---|
| (1R,4S,4aS,5S,8R,8aS,9R,12R)-3-(hydroxymethyl)-8,9-dimethyl-12-(propan-2-yl)-4,4a,5,6,7,8-hexahydro-1,5-butanonaphthalene-4,8a(1H)-diol |
| Synonyms | Source |
|---|---|
| (1R,4S,4aS,5S,8R,8aS,9R,12R)-4,4a,5,6,7,8-hexahydro-3-(hydroxymethyl)-8,9-dimethyl-12-(1-methylethyl)-1,5-butanonaphthalene-4,8a(1H)-diol | ChEBI |
| antibiotic FR 900478 | KNApSAcK |
| (−)-vinigrol | ChEBI |
| UniProt Name | Source |
|---|---|
| vinigrol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00017879 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:111025-83-3 | ChEBI |
| Citations |
|---|