EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42N8O9 |
| Net Charge | 0 |
| Average Mass | 610.669 |
| Monoisotopic Mass | 610.30747 |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N=C(N)N)c1cc(O)c(CO)c(O)c1)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C26H42N8O9/c1-26(2,3)20(23(41)31-14(24(42)43)6-4-5-7-27)34-21(39)15(10-18(28)38)32-22(40)19(33-25(29)30)12-8-16(36)13(11-35)17(37)9-12/h8-9,14-15,19-20,35-37H,4-7,10-11,27H2,1-3H3,(H2,28,38)(H,31,41)(H,32,40)(H,34,39)(H,42,43)(H4,29,30,33)/t14-,15-,19-,20+/m0/s1 |
| InChIKey | CSPZNWQQHHLHIY-HZVDNRATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (1977) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pheganomycin (CHEBI:222202) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-6-amino-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-(diaminomethylideneamino)-2-[3,5-dihydroxy-4-(hydroxymethyl)phenyl]acetyl]amino]-4-oxobutanoyl]amino]-3,3-dimethylbutanoyl]amino]hexanoic acid |