EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H53N5O10 |
| Net Charge | 0 |
| Average Mass | 715.845 |
| Monoisotopic Mass | 715.37924 |
| SMILES | CCCCCCC[C@H](OC(=O)[C@H](CCCCN(O)C(C)=O)NC(=O)c1nc(-c2ccccc2O)oc1C)[C@@H](C)C(=O)N[C@@H]1CCCCN(O)C1=O |
| InChI | InChI=1S/C36H53N5O10/c1-5-6-7-8-9-20-30(23(2)32(44)37-27-17-12-15-22-41(49)35(27)46)51-36(47)28(18-13-14-21-40(48)25(4)42)38-33(45)31-24(3)50-34(39-31)26-16-10-11-19-29(26)43/h10-11,16,19,23,27-28,30,43,48-49H,5-9,12-15,17-18,20-22H2,1-4H3,(H,37,44)(H,38,45)/t23-,27-,28+,30+/m1/s1 |
| InChIKey | YOKHMQIESLOQMH-WAXSWYNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardia asteroides (ncbitaxon:1824) | - | PubMed (4614794) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nocobactin NA 10152A (CHEBI:222178) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(2R,3S)-1-[[(3R)-1-hydroxy-2-oxoazepan-3-yl]amino]-2-methyl-1-oxodecan-3-yl] (2S)-6-[acetyl(hydroxy)amino]-2-[[2-(2-hydroxyphenyl)-5-methyl-1,3-oxazole-4-carbonyl]amino]hexanoate |