EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H80N10O12 |
| Net Charge | 0 |
| Average Mass | 1001.237 |
| Monoisotopic Mass | 1000.59572 |
| SMILES | CC(C)C[C@@H]1NC(=O)CNC(=O)[C@H](C(C)C)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)O)N(C)C1=O |
| InChI | InChI=1S/C49H80N10O12/c1-25(2)20-32-47(69)59(14)41(30(11)61)46(68)56-38(27(5)6)48(70)57(12)34(21-31-18-16-15-17-19-31)43(65)50-23-36(63)54-37(26(3)4)44(66)53-33(24-60)42(64)55-39(28(7)8)49(71)58(13)40(29(9)10)45(67)51-22-35(62)52-32/h15-19,25-30,32-34,37-41,60-61H,20-24H2,1-14H3,(H,50,65)(H,51,67)(H,52,62)(H,53,66)(H,54,63)(H,55,64)(H,56,68)/t30?,32-,33-,34-,37-,38-,39-,40-,41-/m0/s1 |
| InChIKey | XDKZAPYHHPZYCN-MLYXPBMMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sesquicillium (ncbitaxon:122396) | - | PubMed (33356241) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Auyuittuqamide B (CHEBI:222118) is a oligopeptide (CHEBI:25676) |