EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H82N10O12 |
| Net Charge | 0 |
| Average Mass | 1015.264 |
| Monoisotopic Mass | 1014.61137 |
| SMILES | CCC(C)[C@@H]1NC(=O)CNC(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)O)N(C)C(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](C(C)C)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](CO)NC1=O |
| InChI | InChI=1S/C50H82N10O12/c1-15-30(10)40-45(67)54-34(25-61)43(65)56-39(28(6)7)50(72)59(13)41(29(8)9)46(68)52-23-36(63)53-33(21-26(2)3)48(70)60(14)42(31(11)62)47(69)57-38(27(4)5)49(71)58(12)35(22-32-19-17-16-18-20-32)44(66)51-24-37(64)55-40/h16-20,26-31,33-35,38-42,61-62H,15,21-25H2,1-14H3,(H,51,66)(H,52,68)(H,53,63)(H,54,67)(H,55,64)(H,56,65)(H,57,69)/t30?,31?,33-,34-,35-,38-,39-,40-,41-,42-/m0/s1 |
| InChIKey | NEPIEIPMPBPITI-GMSVCCCRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sesquicillium (ncbitaxon:122396) | - | PubMed (33356241) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Auyuittuqamide A (CHEBI:222115) is a oligopeptide (CHEBI:25676) |