EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O4 |
| Net Charge | 0 |
| Average Mass | 262.305 |
| Monoisotopic Mass | 262.12051 |
| SMILES | CC(=C/C(=O)O)/C=C/[C@@]1(C)C=CC(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C15H18O4/c1-10(9-12(17)18)5-7-15(4)8-6-11(16)14(2,3)13(15)19/h5-9H,1-4H3,(H,17,18)/b7-5+,10-9-/t15-/m0/s1 |
| InChIKey | ADCHZDGXZCLAQL-AWNMEBKCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botrytis (ncbitaxon:33196) | - | PubMed (19003608) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Botrytisic acid B (CHEBI:222111) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2Z,4E)-3-methyl-5-(1,5,5-trimethyl-4,6-dioxocyclohex-2-en-1-yl)penta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435037 | ChemSpider |