EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17NO3 |
| Net Charge | 0 |
| Average Mass | 259.305 |
| Monoisotopic Mass | 259.12084 |
| SMILES | C=C[C@]1(O)CC(NCCc2ccc(O)cc2)=CC1=O |
| InChI | InChI=1S/C15H17NO3/c1-2-15(19)10-12(9-14(15)18)16-8-7-11-3-5-13(17)6-4-11/h2-6,9,16-17,19H,1,7-8,10H2/t15-/m0/s1 |
| InChIKey | QNQUWKMQUOYBLF-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (16320764) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5R) 5-hydroxy-3-[[2-(4-hydroxyphenyl)ethyl]amino]-5-vinyl-2-cyclopenten-1-one (CHEBI:222098) is a primary amine (CHEBI:32877) |
| IUPAC Name |
|---|
| (5R)-5-ethenyl-5-hydroxy-3-[2-(4-hydroxyphenyl)ethylamino]cyclopent-2-en-1-one |
| Manual Xrefs | Databases |
|---|---|
| 9747223 | ChemSpider |