EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15NO5 |
| Net Charge | 0 |
| Average Mass | 277.276 |
| Monoisotopic Mass | 277.09502 |
| SMILES | C/C=C/C=C/C=C/C(O)=C1\C(=O)N[C@@H](CC(=O)O)C1=O |
| InChI | InChI=1S/C14H15NO5/c1-2-3-4-5-6-7-10(16)12-13(19)9(8-11(17)18)15-14(12)20/h2-7,9,16H,8H2,1H3,(H,15,20)(H,17,18)/b3-2+,5-4+,7-6+,12-10+/t9-/m0/s1 |
| InChIKey | VUKQFOBCWCOKLO-FTQWZCPCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calcarisporium (ncbitaxon:150368) | - | PubMed (34542281) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MCA17-1 (CHEBI:222092) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 2-[(2S,4E)-4-[(2E,4E,6E)-1-hydroxyocta-2,4,6-trienylidene]-3,5-dioxopyrrolidin-2-yl]acetic acid |