EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H51N11O11S |
| Net Charge | 0 |
| Average Mass | 857.948 |
| Monoisotopic Mass | 857.34902 |
| SMILES | C/C=C(\NC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)OC)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1c1nc(C(=O)N[C@@H](CCC(N)=O)C(=O)O)cs1 |
| InChI | InChI=1S/C37H51N11O11S/c1-4-22(46-37(58)47-25(35(57)59-3)17-20-9-11-21(49)12-10-20)30(52)42-19(2)29(51)43-23(7-5-15-41-36(39)40)33(54)48-16-6-8-27(48)32-45-26(18-60-32)31(53)44-24(34(55)56)13-14-28(38)50/h4,9-12,18-19,23-25,27,49H,5-8,13-17H2,1-3H3,(H2,38,50)(H,42,52)(H,43,51)(H,44,53)(H,55,56)(H4,39,40,41)(H2,46,47,58)/b22-4-/t19-,23-,24-,25-,27-/m0/s1 |
| InChIKey | TVNCPMSTRIQNRC-MUBRTIPBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudovibrio (ncbitaxon:258255) | - | PubMed (33961724) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pseudovibriamide A5 (CHEBI:222018) is a polypeptide (CHEBI:15841) |