EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H45N11O10S |
| Net Charge | 0 |
| Average Mass | 811.879 |
| Monoisotopic Mass | 811.30716 |
| SMILES | C/C=C(/C(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1c1nc(C(=O)N[C@@H](CCC(N)=O)C(=O)O)cs1)N1C(=O)N[C@@H](Cc2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C35H45N11O10S/c1-2-24(46-32(53)22(44-35(46)56)15-18-7-9-19(47)10-8-18)29(51)40-16-27(49)41-20(5-3-13-39-34(37)38)31(52)45-14-4-6-25(45)30-43-23(17-57-30)28(50)42-21(33(54)55)11-12-26(36)48/h2,7-10,17,20-22,25,47H,3-6,11-16H2,1H3,(H2,36,48)(H,40,51)(H,41,49)(H,42,50)(H,44,56)(H,54,55)(H4,37,38,39)/b24-2-/t20-,21-,22-,25-/m0/s1 |
| InChIKey | IXXSEHJMHZWUOA-AVAAIMMPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudovibrio (ncbitaxon:258255) | - | PubMed (33961724) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pseudovibriamide A4 (CHEBI:222015) is a oligopeptide (CHEBI:25676) |