EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H47N11O10S |
| Net Charge | 0 |
| Average Mass | 825.906 |
| Monoisotopic Mass | 825.32281 |
| SMILES | C/C=C(/C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1c1nc(C(=O)N[C@@H](CCC(N)=O)C(=O)O)cs1)N1C(=O)N[C@@H](Cc2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C36H47N11O10S/c1-3-25(47-33(54)23(45-36(47)57)16-19-8-10-20(48)11-9-19)30(52)41-18(2)28(50)42-21(6-4-14-40-35(38)39)32(53)46-15-5-7-26(46)31-44-24(17-58-31)29(51)43-22(34(55)56)12-13-27(37)49/h3,8-11,17-18,21-23,26,48H,4-7,12-16H2,1-2H3,(H2,37,49)(H,41,52)(H,42,50)(H,43,51)(H,45,57)(H,55,56)(H4,38,39,40)/b25-3-/t18-,21-,22-,23-,26-/m0/s1 |
| InChIKey | LEZJVJSLKVKQPP-NKVYNWHTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudovibrio (ncbitaxon:258255) | - | PubMed (33961724) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pseudovibriamide A2 (CHEBI:222005) is a oligopeptide (CHEBI:25676) |