EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H39NO6 |
| Net Charge | 0 |
| Average Mass | 461.599 |
| Monoisotopic Mass | 461.27774 |
| SMILES | CCCCC[C@H]1OC(=O)C[C@@H](O)[C@H](Cc2ccccc2)N(C)C(=O)[C@H](C(C)C)OC(=O)[C@H]1C |
| InChI | InChI=1S/C26H39NO6/c1-6-7-9-14-22-18(4)26(31)33-24(17(2)3)25(30)27(5)20(21(28)16-23(29)32-22)15-19-12-10-8-11-13-19/h8,10-13,17-18,20-22,24,28H,6-7,9,14-16H2,1-5H3/t18-,20-,21+,22+,24-/m0/s1 |
| InChIKey | BLSCHOWASFDSBC-BIRKEBMYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fischerellaspecies PCC 9431 (ncbitaxon:1173023) | - | PubMed (33599093) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hapalosin F (CHEBI:221972) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| (2S,5S,6R,10R,11S)-5-benzyl-6-hydroxy-4,11-dimethyl-10-pentyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione |