EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H41NO6 |
| Net Charge | 0 |
| Average Mass | 475.626 |
| Monoisotopic Mass | 475.29339 |
| SMILES | CCCCCCC[C@H]1OC(=O)C[C@@H](O)[C@H](Cc2ccccc2)N(C)C(=O)[C@H](CC)OC(=O)[C@H]1C |
| InChI | InChI=1S/C27H41NO6/c1-5-7-8-9-13-16-24-19(3)27(32)34-23(6-2)26(31)28(4)21(22(29)18-25(30)33-24)17-20-14-11-10-12-15-20/h10-12,14-15,19,21-24,29H,5-9,13,16-18H2,1-4H3/t19-,21-,22+,23-,24+/m0/s1 |
| InChIKey | AZBCVXGNHJUBLD-SMQFJCFBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fischerellaspecies PCC 9431 (ncbitaxon:1173023) | - | PubMed (33599093) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hapalosin E (CHEBI:221966) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| (2S,5S,6R,10R,11S)-5-benzyl-2-ethyl-10-heptyl-6-hydroxy-4,11-dimethyl-1,9-dioxa-4-azacyclododecane-3,8,12-trione |