EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO8S |
| Net Charge | 0 |
| Average Mass | 409.416 |
| Monoisotopic Mass | 409.08314 |
| SMILES | COC1=C(C)C(=O)c2c(cc(O)c(CSC[C@H](NC(C)=O)C(=O)O)c2O)C1=O |
| InChI | InChI=1S/C18H19NO8S/c1-7-14(22)13-9(16(24)17(7)27-3)4-12(21)10(15(13)23)5-28-6-11(18(25)26)19-8(2)20/h4,11,21,23H,5-6H2,1-3H3,(H,19,20)(H,25,26)/t11-/m0/s1 |
| InChIKey | UJIIOEFFGQEVBT-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (2824420) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fibrostatin D (CHEBI:221962) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-[(1,3-dihydroxy-6-methoxy-7-methyl-5,8-dioxonaphthalen-2-yl)methylsulanyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 21248045 | ChemSpider |