EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H47ClN4O6 |
| Net Charge | 0 |
| Average Mass | 583.170 |
| Monoisotopic Mass | 582.31841 |
| SMILES | CC(C)=CC(=O)[C@@H]1O[C@@H]1/C=C/CC(=O)N[C@H](CN(C)C)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)C(C)Cl)C(C)C |
| InChI | InChI=1S/C29H47ClN4O6/c1-16(2)13-20(26(37)19(7)30)32-29(39)25(18(5)6)33-28(38)21(15-34(8)9)31-24(36)12-10-11-23-27(40-23)22(35)14-17(3)4/h10-11,14,16,18-21,23,25,27H,12-13,15H2,1-9H3,(H,31,36)(H,32,39)(H,33,38)/b11-10+/t19?,20-,21+,23+,25-,27-/m0/s1 |
| InChIKey | MPRXTWVPYGPZSF-LVHWZTDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sandaracinus (ncbitaxon:1055688) | - | PubMed (33534143) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sandarazol C (CHEBI:221949) is a dipeptide (CHEBI:46761) |