EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46N4O6 |
| Net Charge | 0 |
| Average Mass | 558.720 |
| Monoisotopic Mass | 558.34174 |
| SMILES | CC(C)=CC(=O)/C=C/C=C/CC(=O)N[C@H](CN(C)C)C(=O)N[C@H](C(=O)N1C(=O)C(C)=C(O)[C@@H]1CC(C)C)C(C)C |
| InChI | InChI=1S/C30H46N4O6/c1-18(2)15-22(35)13-11-10-12-14-25(36)31-23(17-33(8)9)28(38)32-26(20(5)6)30(40)34-24(16-19(3)4)27(37)21(7)29(34)39/h10-13,15,19-20,23-24,26,37H,14,16-17H2,1-9H3,(H,31,36)(H,32,38)/b12-10+,13-11+/t23-,24+,26+/m1/s1 |
| InChIKey | AWOIESPLBOHTGL-ZHOPJZPESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sandaracinus (ncbitaxon:1055688) | - | PubMed (33534143) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sandarazol E (CHEBI:221936) is a dipeptide (CHEBI:46761) |