EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H38O10S |
| Net Charge | 0 |
| Average Mass | 710.801 |
| Monoisotopic Mass | 710.21857 |
| SMILES | COc1cccc2c1[C@@H](O)c1c(Sc3cc4c(c5c3[C@H](O)c3c(OC)cccc3[C@@H]5O)C(=O)C[C@](C)(O)C4)cc3c(c1[C@H]2O)C(=O)C[C@](C)(O)C3 |
| InChI | InChI=1S/C40H38O10S/c1-39(47)13-17-11-25(31-33(27(17)21(41)15-39)35(43)19-7-5-9-23(49-3)29(19)37(31)45)51-26-12-18-14-40(2,48)16-22(42)28(18)34-32(26)38(46)30-20(36(34)44)8-6-10-24(30)50-4/h5-12,35-38,43-48H,13-16H2,1-4H3/t35-,36-,37+,38+,39+,40+/m0/s1 |
| InChIKey | USDHYXUFMLHCFK-OYEZVYLDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies CB00072 (ncbitaxon:1703928) | - | PubMed (33465268) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thioangucycline A (CHEBI:221903) is a phenanthrol (CHEBI:25962) |