EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37NO4 |
| Net Charge | 0 |
| Average Mass | 415.574 |
| Monoisotopic Mass | 415.27226 |
| SMILES | CC1=C[C@@H]2CCC[C@H](C)[C@H]2[C@H](/C(O)=C2\C(=O)[C@@H](C(C)C)N(C)C2=O)[C@H]1[C@]1(C)O[C@H]1C |
| InChI | InChI=1S/C25H37NO4/c1-12(2)21-23(28)19(24(29)26(21)7)22(27)18-17-13(3)9-8-10-16(17)11-14(4)20(18)25(6)15(5)30-25/h11-13,15-18,20-21,27H,8-10H2,1-7H3/b22-19-/t13-,15-,16-,17+,18-,20-,21+,25+/m0/s1 |
| InChIKey | PEBQSWUQULBCGF-SFOAYJPGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichobotrys (ncbitaxon:1520156) | - | DOI (10.1016/j.tet.2015.10.010) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichobotrysin B (CHEBI:221877) is a N-alkylpyrrolidine (CHEBI:46775) |
| IUPAC Name |
|---|
| (3Z,5R)-3-[[(1S,2R,4aR,8S,8aR)-2-[(2S,3S)-2,3-dimethyloxiran-2-yl]-3,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-hydroxymethylidene]-1-methyl-5-propan-2-ylpyrrolidine-2,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 40256685 | ChemSpider |