EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25NO4 |
| Net Charge | 0 |
| Average Mass | 283.368 |
| Monoisotopic Mass | 283.17836 |
| SMILES | CC(C)CCCC[C@H](O)c1cc(CCCC(=O)O)no1 |
| InChI | InChI=1S/C15H25NO4/c1-11(2)6-3-4-8-13(17)14-10-12(16-20-14)7-5-9-15(18)19/h10-11,13,17H,3-9H2,1-2H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | AYZBMLHVFCLOSX-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces prunicolor (ncbitaxon:67348) | - | PubMed (34617331) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Myxofacycline D (CHEBI:221873) is a heterocyclic fatty acid (CHEBI:48847) |