EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H28N2O8S2 |
| Net Charge | 0 |
| Average Mass | 656.738 |
| Monoisotopic Mass | 656.12871 |
| SMILES | O=C(Cc1ccccc1)O[C@H]1C=CC=C2C[C@@]34SS[C@]5(CC6=COC=C[C@H](OC(=O)[C@H](O)c7ccccc7)[C@H]6N5C3=O)C(=O)N4[C@@H]21 |
| InChI | InChI=1S/C34H28N2O8S2/c37-26(16-20-8-3-1-4-9-20)43-24-13-7-12-22-17-33-31(40)36-28-23(18-34(36,46-45-33)32(41)35(33)27(22)24)19-42-15-14-25(28)44-30(39)29(38)21-10-5-2-6-11-21/h1-15,19,24-25,27-29,38H,16-18H2/t24-,25-,27-,28-,29+,33+,34+/m0/s1 |
| InChIKey | JJGPWGDUIHLXRM-TYQBLOPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus heterothallicus (ncbitaxon:41742) | - | PubMed (2482137) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Emethallicin A (CHEBI:221871) is a 2,5-diketopiperazines (CHEBI:65061) |
| Emethallicin A (CHEBI:221871) is a indoles (CHEBI:24828) |
| Emethallicin A (CHEBI:221871) is a organic disulfide (CHEBI:35489) |
| Emethallicin A (CHEBI:221871) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| [(1R,4S,5S,12R,15S,16S)-2,13-dioxo-16-(2-phenylacetyl)oxy-8-oxa-22,23-dithia-3,14-diazahexacyclo[10.9.2.01,14.03,12.04,10.015,20]tricosa-6,9,17,19-tetraen-5-yl] (2R)-2-hydroxy-2-phenylacetate |
| Manual Xrefs | Databases |
|---|---|
| 143990 | ChemSpider |