EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23NO3 |
| Net Charge | 0 |
| Average Mass | 253.342 |
| Monoisotopic Mass | 253.16779 |
| SMILES | CCCCCCCc1cc(CCCC(=O)O)no1 |
| InChI | InChI=1S/C14H23NO3/c1-2-3-4-5-6-9-13-11-12(15-18-13)8-7-10-14(16)17/h11H,2-10H2,1H3,(H,16,17) |
| InChIKey | CUALQTIVAOUYKB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces prunicolor (ncbitaxon:67348) | - | PubMed (34617331) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Myxofacycline B (CHEBI:221866) is a heterocyclic fatty acid (CHEBI:48847) |