EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15N3 |
| Net Charge | 0 |
| Average Mass | 285.350 |
| Monoisotopic Mass | 285.12660 |
| SMILES | c1ccc2c(C3=NCCc4c3nc3ccccc43)cnc2c1 |
| InChI | InChI=1S/C19H15N3/c1-3-7-16-13(6-1)15(11-21-16)18-19-14(9-10-20-18)12-5-2-4-8-17(12)22-19/h1-8,11,21-22H,9-10H2 |
| InChIKey | JMLJYZDAWISAJY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isoeudistomine U (CHEBI:221813) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-(1H-indol-3-yl)-4,9-dihydro-3H-pyrido[3,4-b]indole |
| Manual Xrefs | Databases |
|---|---|
| 10200243 | ChemSpider |